About 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide
2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide (PubChem CID 10022888) has the molecular formula C20H18F2N4O2
and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide.
Molecular Properties
| Compound Name | 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide |
| PubChem CID | 10022888 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide |
| SMILES | CC(NC(=O)Cc1cc(F)ccc1F)C(=O)Nc1cc(-c2ccccc2)[nH]n1 |
| InChI | InChI=1S/C20H18F2N4O2/c1-12(23-19(27)10-14-9-15(21)7-8-16(14)22)20(28)24-18-11-17(25-26-18)13-5-3-2-4-6-13/h2-9,11-12H,10H2,1H3,(H,23,27)(H2,24,25,26,28) |
| InChIKey | GBOIVAGSGSZLCK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide?
The IUPAC name of 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide (CID 10022888) is 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide.
What is the SMILES notation for 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide?
The canonical SMILES for 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide is CC(NC(=O)Cc1cc(F)ccc1F)C(=O)Nc1cc(-c2ccccc2)[nH]n1.
What is the InChIKey of 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide?
The InChIKey is GBOIVAGSGSZLCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2N4O2/c1-12(23-19(27)10-14-9-15(21)7-8-16(14)22)20(28)24-18-11-17(25-26-18)13-5-3-2-4-6-13/h2-9,11-12H,10H2,1H3,(H,23,27)(H2,24,25,26,28).
What are the key properties of 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide?
2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide has a molecular weight of 384.39 g/mol, XLogP of 3.04, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2,5-difluorophenyl)acetyl]amino]-N-(5-phenyl-1H-pyrazol-3-yl)propanamide is sourced from PubChem (CID 10022888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).