C22H20N6O — CID 10022906
N-[(Z)-(2,2-dimethylchromen-6-yl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 10022906) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[(Z)-(2,2-dimethylchromen-6-yl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(Z)-(2,2-dimethylchromen-6-yl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 10022906 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[(Z)-(2,2-dimethylchromen-6-yl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cn1c2ccccc2c2nnc(N/N=C\c3ccc4c(c3)C=CC(C)(C)O4)nc21 |
| InChI | InChI=1S/C22H20N6O/c1-22(2)11-10-15-12-14(8-9-18(15)29-22)13-23-26-21-24-20-19(25-27-21)16-6-4-5-7-17(16)28(20)3/h4-13H,1-3H3,(H,24,26,27)/b23-13- |
| InChIKey | UDGFHNOJVUGIIE-QRVIBDJDSA-N |
| XLogP | 4.15 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|