C26H37FO — CID 10022930
6-fluoro-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene (PubChem CID 10022930) has the molecular formula C26H37FO and a molecular weight of 384.58 g/mol. Its IUPAC name is 6-fluoro-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene.
| Compound Name | 6-fluoro-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene |
|---|---|
| PubChem CID | 10022930 |
| Molecular Formula | C26H37FO |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 6-fluoro-2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C26H37FO/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-17-26(5)18-16-23-19-24(27)14-15-25(23)28-26/h9,11,13-15,19H,6-8,10,12,16-18H2,1-5H3/b21-11+,22-13+ |
| InChIKey | YWPZAIJLHVVHFP-ZGRPYONQSA-N |
| XLogP | 8.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|