C25H27NO3 — CID 10023244
6-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid (PubChem CID 10023244) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 6-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 10023244 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 6-[(4,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C25H27NO3/c1-25(2,24(27)28)15-9-10-16-29-23-18-21(19-11-5-3-6-12-19)17-22(26-23)20-13-7-4-8-14-20/h3-8,11-14,17-18H,9-10,15-16H2,1-2H3,(H,27,28) |
| InChIKey | KPQMGPINRWJVQJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|