C20H27NO5S — CID 10023506
4-[2-[(4S)-4-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]butanoic acid (PubChem CID 10023506) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is 4-[2-[(4S)-4-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(4S)-4-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 10023506 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 4-[2-[(4S)-4-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]butanoic acid |
| SMILES | Cc1cccc(C[C@H](O)/C=C/[C@H]2COC(=O)N2CCSCCCC(=O)O)c1 |
| InChI | InChI=1S/C20H27NO5S/c1-15-4-2-5-16(12-15)13-18(22)8-7-17-14-26-20(25)21(17)9-11-27-10-3-6-19(23)24/h2,4-5,7-8,12,17-18,22H,3,6,9-11,13-14H2,1H3,(H,23,24)/b8-7+/t17-,18+/m0/s1 |
| InChIKey | LXIKXYLAOXWTDX-KBSZCIAZSA-N |
| XLogP | 2.87 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|