About 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea
1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea (PubChem CID 10023571) has the molecular formula C25H34N2O2
and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea.
Molecular Properties
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea |
| PubChem CID | 10023571 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCC1(c2ccc(O)cc2)CCCC1 |
| InChI | InChI=1S/C25H34N2O2/c1-17(2)21-8-7-9-22(18(3)4)23(21)27-24(29)26-16-25(14-5-6-15-25)19-10-12-20(28)13-11-19/h7-13,17-18,28H,5-6,14-16H2,1-4H3,(H2,26,27,29) |
| InChIKey | SITWDOURDRGUCS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea?
The IUPAC name of 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea (CID 10023571) is 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea.
What is the SMILES notation for 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea?
The canonical SMILES for 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea is CC(C)c1cccc(C(C)C)c1NC(=O)NCC1(c2ccc(O)cc2)CCCC1.
What is the InChIKey of 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea?
The InChIKey is SITWDOURDRGUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34N2O2/c1-17(2)21-8-7-9-22(18(3)4)23(21)27-24(29)26-16-25(14-5-6-15-25)19-10-12-20(28)13-11-19/h7-13,17-18,28H,5-6,14-16H2,1-4H3,(H2,26,27,29).
What are the key properties of 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea?
1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea has a molecular weight of 394.56 g/mol, XLogP of 6.27, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-di(propan-2-yl)phenyl]-3-[[1-(4-hydroxyphenyl)cyclopentyl]methyl]urea is sourced from PubChem (CID 10023571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).