C23H16N4OS — CID 10023655
10-oxo-3-phenyl-5-pyrrolidin-1-yl-8-thia-6,15-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2(7),3,5,11,13-hexaene-4-carbonitrile (PubChem CID 10023655) has the molecular formula C23H16N4OS and a molecular weight of 396.48 g/mol. Its IUPAC name is 10-oxo-3-phenyl-5-pyrrolidin-1-yl-8-thia-6,15-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2(7),3,5,11,13-hexaene-4-carbonitrile.
| Compound Name | 10-oxo-3-phenyl-5-pyrrolidin-1-yl-8-thia-6,15-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2(7),3,5,11,13-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 10023655 |
| Molecular Formula | C23H16N4OS |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 10-oxo-3-phenyl-5-pyrrolidin-1-yl-8-thia-6,15-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),2(7),3,5,11,13-hexaene-4-carbonitrile |
| SMILES | N#Cc1c(N2CCCC2)nc2sc3c(c2c1-c1ccccc1)-n1cccc1C3=O |
| InChI | InChI=1S/C23H16N4OS/c24-13-15-17(14-7-2-1-3-8-14)18-19-21(20(28)16-9-6-12-27(16)19)29-23(18)25-22(15)26-10-4-5-11-26/h1-3,6-9,12H,4-5,10-11H2 |
| InChIKey | TVMXARXZRHDDPJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |