C20H26N6O3 — CID 10023782
4-[[4-amino-5-(2-methoxybenzoyl)pyrimidin-2-yl]amino]-N-ethylpiperidine-1-carboxamide (PubChem CID 10023782) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[[4-amino-5-(2-methoxybenzoyl)pyrimidin-2-yl]amino]-N-ethylpiperidine-1-carboxamide.
| Compound Name | 4-[[4-amino-5-(2-methoxybenzoyl)pyrimidin-2-yl]amino]-N-ethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 10023782 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-[[4-amino-5-(2-methoxybenzoyl)pyrimidin-2-yl]amino]-N-ethylpiperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC(Nc2ncc(C(=O)c3ccccc3OC)c(N)n2)CC1 |
| InChI | InChI=1S/C20H26N6O3/c1-3-22-20(28)26-10-8-13(9-11-26)24-19-23-12-15(18(21)25-19)17(27)14-6-4-5-7-16(14)29-2/h4-7,12-13H,3,8-11H2,1-2H3,(H,22,28)(H3,21,23,24,25) |
| InChIKey | GIFWLUDQYFWBMB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |