C27H28O3 — CID 10023931
4-(7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g][1]benzofuran-3-yl)benzoic acid (PubChem CID 10023931) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-(7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g][1]benzofuran-3-yl)benzoic acid.
| Compound Name | 4-(7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g][1]benzofuran-3-yl)benzoic acid |
|---|---|
| PubChem CID | 10023931 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 4-(7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g][1]benzofuran-3-yl)benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)CCc1c(-c2ccc(C(=O)O)cc2)coc1-3 |
| InChI | InChI=1S/C27H28O3/c1-26(2)11-12-27(3,4)23-14-20-18(13-22(23)26)9-10-19-21(15-30-24(19)20)16-5-7-17(8-6-16)25(28)29/h5-8,13-15H,9-12H2,1-4H3,(H,28,29) |
| InChIKey | VNKHPMXFCURIPL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |