About N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide
N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide (PubChem CID 10023953) has the molecular formula C18H16ClF3N2O3
and a molecular weight of 400.78 g/mol. Its IUPAC name is N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide.
Molecular Properties
| Compound Name | N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide |
| PubChem CID | 10023953 |
| Molecular Formula | C18H16ClF3N2O3 |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(F)c(F)nc(F)c2Cl)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H16ClF3N2O3/c1-26-11-7-6-9(8-12(11)27-10-4-2-3-5-10)18(25)23-15-13(19)16(21)24-17(22)14(15)20/h6-8,10H,2-5H2,1H3,(H,23,24,25) |
| InChIKey | UNAHUQXNPYRZGJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide?
The IUPAC name of N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide (CID 10023953) is N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide.
What is the SMILES notation for N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide?
The canonical SMILES for N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide is COc1ccc(C(=O)Nc2c(F)c(F)nc(F)c2Cl)cc1OC1CCCC1.
What is the InChIKey of N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide?
The InChIKey is UNAHUQXNPYRZGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClF3N2O3/c1-26-11-7-6-9(8-12(11)27-10-4-2-3-5-10)18(25)23-15-13(19)16(21)24-17(22)14(15)20/h6-8,10H,2-5H2,1H3,(H,23,24,25).
What are the key properties of N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide?
N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide has a molecular weight of 400.78 g/mol, XLogP of 4.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)-3-cyclopentyloxy-4-methoxybenzamide is sourced from PubChem (CID 10023953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).