C18H27NO7S — CID 10023995
2,2-dimethylpropanoyloxymethyl 2-[(3R,4R)-3-acetyloxy-3-ethyl-2-oxo-4-sulfanylazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 10023995) has the molecular formula C18H27NO7S and a molecular weight of 401.48 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 2-[(3R,4R)-3-acetyloxy-3-ethyl-2-oxo-4-sulfanylazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 2-[(3R,4R)-3-acetyloxy-3-ethyl-2-oxo-4-sulfanylazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 10023995 |
| Molecular Formula | C18H27NO7S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 2-[(3R,4R)-3-acetyloxy-3-ethyl-2-oxo-4-sulfanylazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CC[C@@]1(OC(C)=O)C(=O)N(C(C(=O)OCOC(=O)C(C)(C)C)=C(C)C)[C@@H]1S |
| InChI | InChI=1S/C18H27NO7S/c1-8-18(26-11(4)20)14(22)19(15(18)27)12(10(2)3)13(21)24-9-25-16(23)17(5,6)7/h15,27H,8-9H2,1-7H3/t15-,18-/m1/s1 |
| InChIKey | ZFDHABJIPAFZLC-CRAIPNDOSA-N |
| XLogP | 2.18 |
| TPSA | 99.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|