About 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine
4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine (PubChem CID 10024020) has the molecular formula C22H28ClN3O2
and a molecular weight of 401.94 g/mol. Its IUPAC name is 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine |
| PubChem CID | 10024020 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine |
| SMILES | CCCN(c1nccc(-c2c(Cl)cc(OC)cc2OC)n1)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-4-11-26(21(14-5-6-14)15-7-8-15)22-24-10-9-18(25-22)20-17(23)12-16(27-2)13-19(20)28-3/h9-10,12-15,21H,4-8,11H2,1-3H3 |
| InChIKey | SPFHQARDCUZUIU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine?
The IUPAC name of 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine (CID 10024020) is 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine.
What is the SMILES notation for 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine?
The canonical SMILES for 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine is CCCN(c1nccc(-c2c(Cl)cc(OC)cc2OC)n1)C(C1CC1)C1CC1.
What is the InChIKey of 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine?
The InChIKey is SPFHQARDCUZUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28ClN3O2/c1-4-11-26(21(14-5-6-14)15-7-8-15)22-24-10-9-18(25-22)20-17(23)12-16(27-2)13-19(20)28-3/h9-10,12-15,21H,4-8,11H2,1-3H3.
What are the key properties of 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine?
4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine has a molecular weight of 401.94 g/mol, XLogP of 5.22, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-4,6-dimethoxyphenyl)-N-(dicyclopropylmethyl)-N-propylpyrimidin-2-amine is sourced from PubChem (CID 10024020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).