C20H21NO8 — CID 10024095
diethyl (5S)-8,9-dimethoxy-2,3-dioxo-5,6-dihydropyrrolo[2,1-a]isoquinoline-1,5-dicarboxylate (PubChem CID 10024095) has the molecular formula C20H21NO8 and a molecular weight of 403.39 g/mol. Its IUPAC name is diethyl (5S)-8,9-dimethoxy-2,3-dioxo-5,6-dihydropyrrolo[2,1-a]isoquinoline-1,5-dicarboxylate.
| Compound Name | diethyl (5S)-8,9-dimethoxy-2,3-dioxo-5,6-dihydropyrrolo[2,1-a]isoquinoline-1,5-dicarboxylate |
|---|---|
| PubChem CID | 10024095 |
| Molecular Formula | C20H21NO8 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | diethyl (5S)-8,9-dimethoxy-2,3-dioxo-5,6-dihydropyrrolo[2,1-a]isoquinoline-1,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C2c3cc(OC)c(OC)cc3C[C@@H](C(=O)OCC)N2C(=O)C1=O |
| InChI | InChI=1S/C20H21NO8/c1-5-28-19(24)12-7-10-8-13(26-3)14(27-4)9-11(10)16-15(20(25)29-6-2)17(22)18(23)21(12)16/h8-9,12H,5-7H2,1-4H3/t12-/m0/s1 |
| InChIKey | KYTIXKFQXSVYKX-LBPRGKRZSA-N |
| XLogP | 0.88 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|