C21H24N6OS — CID 10024433
1-(4-(4-(4-(2,4-Dimethylthiazol-5-yl)pyrimidin-2-ylamino)phenyl)piperazin-1-yl)ethanone (PubChem CID 10024433) has the molecular formula C21H24N6OS and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(4-(4-(4-(2,4-Dimethylthiazol-5-yl)pyrimidin-2-ylamino)phenyl)piperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 10024433 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC1=C(SC(=N1)C)C2=NC(=NC=C2)NC3=CC=C(C=C3)N4CCN(CC4)C(=O)C |
| InChI | InChI=1S/C21H24N6OS/c1-14-20(29-15(2)23-14)19-8-9-22-21(25-19)24-17-4-6-18(7-5-17)27-12-10-26(11-13-27)16(3)28/h4-9H,10-13H2,1-3H3,(H,22,24,25) |
| InChIKey | WMIWANZLOJYLPU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | 549 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|