C26H40O2Si — CID 10024687
(3R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-ol (PubChem CID 10024687) has the molecular formula C26H40O2Si and a molecular weight of 412.69 g/mol. Its IUPAC name is (3R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-ol.
| Compound Name | (3R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-ol |
|---|---|
| PubChem CID | 10024687 |
| Molecular Formula | C26H40O2Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (3R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-ol |
| SMILES | CC[C@@H](CC[C@@H](O)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H40O2Si/c1-8-21(19-20-24(27)25(2,3)4)28-29(26(5,6)7,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,21,24,27H,8,19-20H2,1-7H3/t21-,24+/m0/s1 |
| InChIKey | RIWQMEWOQLEYAR-XUZZJYLKSA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|