C20H25F2NO4S — CID 10024738
7-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]heptanoic acid (PubChem CID 10024738) has the molecular formula C20H25F2NO4S and a molecular weight of 413.49 g/mol. Its IUPAC name is 7-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]heptanoic acid.
| Compound Name | 7-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 10024738 |
| Molecular Formula | C20H25F2NO4S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 7-[4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazolidin-3-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)SCC1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C20H25F2NO4S/c21-20(22,15-8-4-3-5-9-15)17(24)12-11-16-14-28-19(27)23(16)13-7-2-1-6-10-18(25)26/h3-5,8-9,11-12,16-17,24H,1-2,6-7,10,13-14H2,(H,25,26)/b12-11+ |
| InChIKey | HLLMKHSJFZGZPV-VAWYXSNFSA-N |
| XLogP | 4.27 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|