C18H34O7P2 — CID 10025359
[(2Z,6E)-3-tert-butyl-7,11-dimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate (PubChem CID 10025359) has the molecular formula C18H34O7P2 and a molecular weight of 424.41 g/mol. Its IUPAC name is [(2Z,6E)-3-tert-butyl-7,11-dimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate.
| Compound Name | [(2Z,6E)-3-tert-butyl-7,11-dimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10025359 |
| Molecular Formula | C18H34O7P2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [(2Z,6E)-3-tert-butyl-7,11-dimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/COP(=O)(O)OP(=O)(O)O)C(C)(C)C |
| InChI | InChI=1S/C18H34O7P2/c1-15(2)9-7-10-16(3)11-8-12-17(18(4,5)6)13-14-24-27(22,23)25-26(19,20)21/h9,11,13H,7-8,10,12,14H2,1-6H3,(H,22,23)(H2,19,20,21)/b16-11+,17-13- |
| InChIKey | UEAFSQXNJOKNMX-ADPXBSPTSA-N |
| XLogP | 5.66 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|