C23H22O8 — CID 10025476
5-[(3R,5S)-11-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 10025476) has the molecular formula C23H22O8 and a molecular weight of 426.42 g/mol. Its IUPAC name is 5-[(3R,5S)-11-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3R,5S)-11-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 10025476 |
| Molecular Formula | C23H22O8 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 5-[(3R,5S)-11-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C2C3C4C(=C5C(=O)OC(C)(C)OC5=O)C5C2[C@H]2C[C@@H]5C4C32)C(=O)O1 |
| InChI | InChI=1S/C23H22O8/c1-22(2)28-18(24)16(19(25)29-22)14-10-6-5-7-9-8(6)12(14)13(9)15(11(7)10)17-20(26)30-23(3,4)31-21(17)27/h6-13H,5H2,1-4H3/t6-,7+,8?,9?,10?,11?,12?,13? |
| InChIKey | NGQONMCYYIFSHF-NJXBWVHSSA-N |
| XLogP | 1.64 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|