C30H50O — CID 10025514
(1R,2R,4S,9R,11R,14R,15R,18S,20R)-1,2,8,8,15,19,19-heptamethyl-5-methylidenepentacyclo[12.8.0.02,11.04,9.015,20]docosan-18-ol (PubChem CID 10025514) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (1R,2R,4S,9R,11R,14R,15R,18S,20R)-1,2,8,8,15,19,19-heptamethyl-5-methylidenepentacyclo[12.8.0.02,11.04,9.015,20]docosan-18-ol.
| Compound Name | (1R,2R,4S,9R,11R,14R,15R,18S,20R)-1,2,8,8,15,19,19-heptamethyl-5-methylidenepentacyclo[12.8.0.02,11.04,9.015,20]docosan-18-ol |
|---|---|
| PubChem CID | 10025514 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (1R,2R,4S,9R,11R,14R,15R,18S,20R)-1,2,8,8,15,19,19-heptamethyl-5-methylidenepentacyclo[12.8.0.02,11.04,9.015,20]docosan-18-ol |
| SMILES | C=C1CCC(C)(C)[C@@H]2C[C@H]3CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)C[C@H]12 |
| InChI | InChI=1S/C30H50O/c1-19-11-14-26(2,3)22-17-20-9-10-24-28(6)15-13-25(31)27(4,5)23(28)12-16-29(24,7)30(20,8)18-21(19)22/h20-25,31H,1,9-18H2,2-8H3/t20-,21-,22-,23+,24-,25+,28+,29-,30-/m1/s1 |
| InChIKey | WZNULLZQWFAQJO-PNZOOJBUSA-N |
| XLogP | 8.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|