C21H27F2NO4S — CID 10025550
3-[4-[(2R)-2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]propanoic acid (PubChem CID 10025550) has the molecular formula C21H27F2NO4S and a molecular weight of 427.51 g/mol. Its IUPAC name is 3-[4-[(2R)-2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]propanoic acid.
| Compound Name | 3-[4-[(2R)-2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 10025550 |
| Molecular Formula | C21H27F2NO4S |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 3-[4-[(2R)-2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCCCCN1C(=O)CC[C@@H]1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C21H27F2NO4S/c22-21(23,16-6-2-1-3-7-16)18(25)10-8-17-9-11-19(26)24(17)13-4-5-14-29-15-12-20(27)28/h1-3,6-8,10,17-18,25H,4-5,9,11-15H2,(H,27,28)/b10-8+/t17-,18?/m0/s1 |
| InChIKey | PRPJPLURSBOLKQ-NBGZVGPFSA-N |
| XLogP | 3.67 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|