About (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate
(3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate (PubChem CID 10025594) has the molecular formula C26H24N2O4
and a molecular weight of 428.49 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate |
| PubChem CID | 10025594 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate |
| SMILES | COc1cccc(COC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N2O4/c1-31-21-11-7-8-18(14-21)17-32-26(30)24(28-25(29)19-9-3-2-4-10-19)15-20-16-27-23-13-6-5-12-22(20)23/h2-14,16,24,27H,15,17H2,1H3,(H,28,29)/t24-/m0/s1 |
| InChIKey | NOEXOHLZBNPZCS-DEOSSOPVSA-N |
| XLogP | 4.26 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate?
The IUPAC name of (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate (CID 10025594) is (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate.
What is the SMILES notation for (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate?
The canonical SMILES for (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate is COc1cccc(COC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1.
What is the InChIKey of (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate?
The InChIKey is NOEXOHLZBNPZCS-DEOSSOPVSA-N. The full InChI is InChI=1S/C26H24N2O4/c1-31-21-11-7-8-18(14-21)17-32-26(30)24(28-25(29)19-9-3-2-4-10-19)15-20-16-27-23-13-6-5-12-22(20)23/h2-14,16,24,27H,15,17H2,1H3,(H,28,29)/t24-/m0/s1.
What are the key properties of (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate?
(3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate has a molecular weight of 428.49 g/mol, XLogP of 4.26, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate is sourced from PubChem (CID 10025594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).