C21H33FO6Si — CID 10025608
(1S,4S,10S,11S,12R)-11-(3-fluoropropyl)-4-methyl-8,8-di(propan-2-yl)-3,7,9,13-tetraoxa-8-silatricyclo[10.2.2.01,10]hexadec-15-ene-2,14-dione (PubChem CID 10025608) has the molecular formula C21H33FO6Si and a molecular weight of 428.57 g/mol. Its IUPAC name is (1S,4S,10S,11S,12R)-11-(3-fluoropropyl)-4-methyl-8,8-di(propan-2-yl)-3,7,9,13-tetraoxa-8-silatricyclo[10.2.2.01,10]hexadec-15-ene-2,14-dione.
| Compound Name | (1S,4S,10S,11S,12R)-11-(3-fluoropropyl)-4-methyl-8,8-di(propan-2-yl)-3,7,9,13-tetraoxa-8-silatricyclo[10.2.2.01,10]hexadec-15-ene-2,14-dione |
|---|---|
| PubChem CID | 10025608 |
| Molecular Formula | C21H33FO6Si |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (1S,4S,10S,11S,12R)-11-(3-fluoropropyl)-4-methyl-8,8-di(propan-2-yl)-3,7,9,13-tetraoxa-8-silatricyclo[10.2.2.01,10]hexadec-15-ene-2,14-dione |
| SMILES | CC(C)[Si]1(C(C)C)OCC[C@H](C)OC(=O)[C@@]23C=C[C@@H](OC2=O)[C@H](CCCF)[C@@H]3O1 |
| InChI | InChI=1S/C21H33FO6Si/c1-13(2)29(14(3)4)25-12-9-15(5)26-19(23)21-10-8-17(27-20(21)24)16(7-6-11-22)18(21)28-29/h8,10,13-18H,6-7,9,11-12H2,1-5H3/t15-,16-,17+,18-,21-/m0/s1 |
| InChIKey | SIZIFBOBXZZQNM-CURYNPBISA-N |
| XLogP | 3.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|