C21H17F3N4O3 — CID 10025695
7-[(1S,2R,5S,6S)-6-amino-2-methyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 10025695) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is 7-[(1S,2R,5S,6S)-6-amino-2-methyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-[(1S,2R,5S,6S)-6-amino-2-methyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 10025695 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 7-[(1S,2R,5S,6S)-6-amino-2-methyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | C[C@@H]1[C@@H]2[C@@H](N)[C@@H]2CN1c1nc2c(cc1F)c(=O)c(C(=O)O)cn2-c1ccc(F)cc1F |
| InChI | InChI=1S/C21H17F3N4O3/c1-8-16-11(17(16)25)6-27(8)20-14(24)5-10-18(29)12(21(30)31)7-28(19(10)26-20)15-3-2-9(22)4-13(15)23/h2-5,7-8,11,16-17H,6,25H2,1H3,(H,30,31)/t8-,11-,16+,17+/m1/s1 |
| InChIKey | QCZRUKIVQRTIFC-NUNZNLDCSA-N |
| XLogP | 2.28 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |