C17H27N3O8S — CID 10025867
O-[(1R,2R,3R,4S,5S)-2-acetamido-3,4,5-tris(methoxymethoxy)cyclopentyl] imidazole-1-carbothioate (PubChem CID 10025867) has the molecular formula C17H27N3O8S and a molecular weight of 433.48 g/mol. Its IUPAC name is O-[(1R,2R,3R,4S,5S)-2-acetamido-3,4,5-tris(methoxymethoxy)cyclopentyl] imidazole-1-carbothioate.
| Compound Name | O-[(1R,2R,3R,4S,5S)-2-acetamido-3,4,5-tris(methoxymethoxy)cyclopentyl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 10025867 |
| Molecular Formula | C17H27N3O8S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | O-[(1R,2R,3R,4S,5S)-2-acetamido-3,4,5-tris(methoxymethoxy)cyclopentyl] imidazole-1-carbothioate |
| SMILES | COCO[C@@H]1[C@@H](OCOC)[C@H](OC(=S)n2ccnc2)[C@H](NC(C)=O)[C@H]1OCOC |
| InChI | InChI=1S/C17H27N3O8S/c1-11(21)19-12-13(25-8-22-2)15(26-9-23-3)16(27-10-24-4)14(12)28-17(29)20-6-5-18-7-20/h5-7,12-16H,8-10H2,1-4H3,(H,19,21)/t12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | FWRHXJVFXCKUOL-SUJAAXHWSA-N |
| XLogP | -0.11 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|