C24H26N2O4S — CID 10026148
2-[(1S)-5-[3-[[5-(4-ethyl-1,3-thiazol-2-yl)-2-pyridinyl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 10026148) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[[5-(4-ethyl-1,3-thiazol-2-yl)-2-pyridinyl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[[5-(4-ethyl-1,3-thiazol-2-yl)-2-pyridinyl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 10026148 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[(1S)-5-[3-[[5-(4-ethyl-1,3-thiazol-2-yl)-2-pyridinyl]oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | CCc1csc(-c2ccc(OCCCOc3ccc4c(c3)CC[C@H]4CC(=O)O)nc2)n1 |
| InChI | InChI=1S/C24H26N2O4S/c1-2-19-15-31-24(26-19)18-6-9-22(25-14-18)30-11-3-10-29-20-7-8-21-16(12-20)4-5-17(21)13-23(27)28/h6-9,12,14-15,17H,2-5,10-11,13H2,1H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | NDSVGELSLGUYIY-KRWDZBQOSA-N |
| XLogP | 5.12 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|