C22H28N6O4 — CID 10026259
ethyl N-[5-amino-3-[4-(butylcarbamoyloxy)phenyl]-2-methyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate (PubChem CID 10026259) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is ethyl N-[5-amino-3-[4-(butylcarbamoyloxy)phenyl]-2-methyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate.
| Compound Name | ethyl N-[5-amino-3-[4-(butylcarbamoyloxy)phenyl]-2-methyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate |
|---|---|
| PubChem CID | 10026259 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | ethyl N-[5-amino-3-[4-(butylcarbamoyloxy)phenyl]-2-methyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate |
| SMILES | CCCCNC(=O)Oc1ccc(C2=Nc3c(cc(NC(=O)OCC)nc3N)NC2C)cc1 |
| InChI | InChI=1S/C22H28N6O4/c1-4-6-11-24-21(29)32-15-9-7-14(8-10-15)18-13(3)25-16-12-17(27-22(30)31-5-2)26-20(23)19(16)28-18/h7-10,12-13,25H,4-6,11H2,1-3H3,(H,24,29)(H3,23,26,27,30) |
| InChIKey | CPBQWBSDBLQYIE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|