C26H44O4Si — CID 10026697
(1R,3aS,4R,9S,10bS)-9-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-1-propan-2-ylspiro[1,2,3,4,7,8,9,10b-octahydrocyclohepta[e]indene-6,2'-1,3-dioxolane]-4-ol (PubChem CID 10026697) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (1R,3aS,4R,9S,10bS)-9-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-1-propan-2-ylspiro[1,2,3,4,7,8,9,10b-octahydrocyclohepta[e]indene-6,2'-1,3-dioxolane]-4-ol.
| Compound Name | (1R,3aS,4R,9S,10bS)-9-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-1-propan-2-ylspiro[1,2,3,4,7,8,9,10b-octahydrocyclohepta[e]indene-6,2'-1,3-dioxolane]-4-ol |
|---|---|
| PubChem CID | 10026697 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (1R,3aS,4R,9S,10bS)-9-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-1-propan-2-ylspiro[1,2,3,4,7,8,9,10b-octahydrocyclohepta[e]indene-6,2'-1,3-dioxolane]-4-ol |
| SMILES | CC(C)[C@H]1CC[C@]2(C)[C@H](O)C=C3C(=C[C@@H](O[Si](C)(C)C(C)(C)C)CCC34OCCO4)[C@H]12 |
| InChI | InChI=1S/C26H44O4Si/c1-17(2)19-10-11-25(6)22(27)16-21-20(23(19)25)15-18(30-31(7,8)24(3,4)5)9-12-26(21)28-13-14-29-26/h15-19,22-23,27H,9-14H2,1-8H3/t18-,19+,22+,23-,25+/m0/s1 |
| InChIKey | IDYNAOLTLPOZNM-SPJYOYIGSA-N |
| XLogP | 5.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|