About methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate
methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate (PubChem CID 10026731) has the molecular formula C30H27NO3
and a molecular weight of 449.55 g/mol. Its IUPAC name is methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate |
| PubChem CID | 10026731 |
| Molecular Formula | C30H27NO3 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(NC(=O)C(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27NO3/c1-34-30(33)26-19-17-22(18-20-26)21-27(23-11-5-2-6-12-23)31-29(32)28(24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20,27-28H,21H2,1H3,(H,31,32) |
| InChIKey | PLRJNLJFUOQXEN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate?
The IUPAC name of methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate (CID 10026731) is methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate.
What is the SMILES notation for methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate?
The canonical SMILES for methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate is COC(=O)c1ccc(CC(NC(=O)C(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate?
The InChIKey is PLRJNLJFUOQXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H27NO3/c1-34-30(33)26-19-17-22(18-20-26)21-27(23-11-5-2-6-12-23)31-29(32)28(24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20,27-28H,21H2,1H3,(H,31,32).
What are the key properties of methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate?
methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate has a molecular weight of 449.55 g/mol, XLogP of 5.71, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[(2,2-diphenylacetyl)amino]-2-phenylethyl]benzoate is sourced from PubChem (CID 10026731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).