About 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline
1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline (PubChem CID 10026806) has the molecular formula C23H30N2O3S
and a molecular weight of 414.57 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline |
| PubChem CID | 10026806 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline |
| SMILES | O=S(=O)(c1ccccc1)N1CCCc2cc(OCCCN3CCCCC3)ccc21 |
| InChI | InChI=1S/C23H30N2O3S/c26-29(27,22-10-3-1-4-11-22)25-17-7-9-20-19-21(12-13-23(20)25)28-18-8-16-24-14-5-2-6-15-24/h1,3-4,10-13,19H,2,5-9,14-18H2 |
| InChIKey | YYGKOGGYOJTWMV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline?
The IUPAC name of 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline (CID 10026806) is 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline?
The canonical SMILES for 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline is O=S(=O)(c1ccccc1)N1CCCc2cc(OCCCN3CCCCC3)ccc21.
What is the InChIKey of 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline?
The InChIKey is YYGKOGGYOJTWMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O3S/c26-29(27,22-10-3-1-4-11-22)25-17-7-9-20-19-21(12-13-23(20)25)28-18-8-16-24-14-5-2-6-15-24/h1,3-4,10-13,19H,2,5-9,14-18H2.
What are the key properties of 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline?
1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline has a molecular weight of 414.57 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-6-(3-piperidin-1-ylpropoxy)-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 10026806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).