C24H25F2N5O2 — CID 10026920
(5R)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-[3-[3-(2H-tetrazol-5-yl)phenyl]propyl]pyrrolidin-2-one (PubChem CID 10026920) has the molecular formula C24H25F2N5O2 and a molecular weight of 453.49 g/mol. Its IUPAC name is (5R)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-[3-[3-(2H-tetrazol-5-yl)phenyl]propyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-[3-[3-(2H-tetrazol-5-yl)phenyl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10026920 |
| Molecular Formula | C24H25F2N5O2 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | (5R)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-1-[3-[3-(2H-tetrazol-5-yl)phenyl]propyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](/C=C/C(O)C(F)(F)c2ccccc2)N1CCCc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C24H25F2N5O2/c25-24(26,19-9-2-1-3-10-19)21(32)13-11-20-12-14-22(33)31(20)15-5-7-17-6-4-8-18(16-17)23-27-29-30-28-23/h1-4,6,8-11,13,16,20-21,32H,5,7,12,14-15H2,(H,27,28,29,30)/b13-11+/t20-,21?/m0/s1 |
| InChIKey | JKFOXPJAWYYJGL-YOMVNTTJSA-N |
| XLogP | 3.50 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|