C21H25F2N3O2S2 — CID 10026938
trans-(1S,2R)-2-[2-[(3,4-difluorophenyl)sulfonylamino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 10026938) has the molecular formula C21H25F2N3O2S2 and a molecular weight of 453.58 g/mol. Its IUPAC name is trans-(1S,2R)-2-[2-[(3,4-difluorophenyl)sulfonylamino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | trans-(1S,2R)-2-[2-[(3,4-difluorophenyl)sulfonylamino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 10026938 |
| Molecular Formula | C21H25F2N3O2S2 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | trans-(1S,2R)-2-[2-[(3,4-difluorophenyl)sulfonylamino]ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CNC(=S)[C@@]1(c2cccnc2)CCCC[C@@H]1CCNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H25F2N3O2S2/c1-24-20(29)21(16-6-4-11-25-14-16)10-3-2-5-15(21)9-12-26-30(27,28)17-7-8-18(22)19(23)13-17/h4,6-8,11,13-15,26H,2-3,5,9-10,12H2,1H3,(H,24,29)/t15-,21+/m1/s1 |
| InChIKey | JHOFTIXFQSLUDA-VFNWGFHPSA-N |
| XLogP | 3.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|