C22H32NO5S+ — CID 10027153
4-(1,3-thiazol-3-ium-3-yl)butyl 4-hexoxy-3,5-dimethoxybenzoate (PubChem CID 10027153) has the molecular formula C22H32NO5S+ and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-(1,3-thiazol-3-ium-3-yl)butyl 4-hexoxy-3,5-dimethoxybenzoate.
| Compound Name | 4-(1,3-thiazol-3-ium-3-yl)butyl 4-hexoxy-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 10027153 |
| Molecular Formula | C22H32NO5S+ |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 4-(1,3-thiazol-3-ium-3-yl)butyl 4-hexoxy-3,5-dimethoxybenzoate |
| SMILES | CCCCCCOc1c(OC)cc(C(=O)OCCCC[n+]2ccsc2)cc1OC |
| InChI | InChI=1S/C22H32NO5S/c1-4-5-6-8-12-27-21-19(25-2)15-18(16-20(21)26-3)22(24)28-13-9-7-10-23-11-14-29-17-23/h11,14-17H,4-10,12-13H2,1-3H3/q+1 |
| InChIKey | VYZGMIXVYWVIRT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|