C16H12ClF5N2O4S — CID 10027203
2-[(2-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxypropanamide (PubChem CID 10027203) has the molecular formula C16H12ClF5N2O4S and a molecular weight of 458.79 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxypropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 10027203 |
| Molecular Formula | C16H12ClF5N2O4S |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxypropanamide |
| SMILES | CC(C(=O)NO)N(Cc1ccccc1Cl)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H12ClF5N2O4S/c1-7(16(25)23-26)24(6-8-4-2-3-5-9(8)17)29(27,28)15-13(21)11(19)10(18)12(20)14(15)22/h2-5,7,26H,6H2,1H3,(H,23,25) |
| InChIKey | VDDKIBQLKXMKIW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|