C20H11Cl5O2 — CID 10027288
(2S,3R)-5,6,8,9-tetrachloro-2-(4-chlorophenyl)-3-phenyl-1-oxaspiro[3.5]nona-5,8-dien-7-one (PubChem CID 10027288) has the molecular formula C20H11Cl5O2 and a molecular weight of 460.57 g/mol. Its IUPAC name is (2S,3R)-5,6,8,9-tetrachloro-2-(4-chlorophenyl)-3-phenyl-1-oxaspiro[3.5]nona-5,8-dien-7-one.
| Compound Name | (2S,3R)-5,6,8,9-tetrachloro-2-(4-chlorophenyl)-3-phenyl-1-oxaspiro[3.5]nona-5,8-dien-7-one |
|---|---|
| PubChem CID | 10027288 |
| Molecular Formula | C20H11Cl5O2 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | (2S,3R)-5,6,8,9-tetrachloro-2-(4-chlorophenyl)-3-phenyl-1-oxaspiro[3.5]nona-5,8-dien-7-one |
| SMILES | O=C1C(Cl)=C(Cl)C2(O[C@H](c3ccc(Cl)cc3)[C@H]2c2ccccc2)C(Cl)=C1Cl |
| InChI | InChI=1S/C20H11Cl5O2/c21-12-8-6-11(7-9-12)17-13(10-4-2-1-3-5-10)20(27-17)18(24)14(22)16(26)15(23)19(20)25/h1-9,13,17H/t13-,17-/m1/s1 |
| InChIKey | AUIYFROCGGLPQH-CXAGYDPISA-N |
| XLogP | 6.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|