C21H36N2O5S2 — CID 10027293
[4-[2-(3-decylsulfinylpropanoylamino)ethyl]phenyl] sulfamate (PubChem CID 10027293) has the molecular formula C21H36N2O5S2 and a molecular weight of 460.66 g/mol. Its IUPAC name is [4-[2-(3-decylsulfinylpropanoylamino)ethyl]phenyl] sulfamate.
| Compound Name | [4-[2-(3-decylsulfinylpropanoylamino)ethyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 10027293 |
| Molecular Formula | C21H36N2O5S2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [4-[2-(3-decylsulfinylpropanoylamino)ethyl]phenyl] sulfamate |
| SMILES | CCCCCCCCCCS(=O)CCC(=O)NCCc1ccc(OS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H36N2O5S2/c1-2-3-4-5-6-7-8-9-17-29(25)18-15-21(24)23-16-14-19-10-12-20(13-11-19)28-30(22,26)27/h10-13H,2-9,14-18H2,1H3,(H,23,24)(H2,22,26,27) |
| InChIKey | QRBVMVPLHHQMBK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|