C28H34N2O4 — CID 10027357
4-[2-[[(E)-3-(1-hexan-3-ylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid (PubChem CID 10027357) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is 4-[2-[[(E)-3-(1-hexan-3-ylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[(E)-3-(1-hexan-3-ylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 10027357 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 4-[2-[[(E)-3-(1-hexan-3-ylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid |
| SMILES | CCCC(CC)n1ccc2cc(/C(C)=C/C(=O)Nc3ccccc3OCCCC(=O)O)ccc21 |
| InChI | InChI=1S/C28H34N2O4/c1-4-9-23(5-2)30-16-15-22-19-21(13-14-25(22)30)20(3)18-27(31)29-24-10-6-7-11-26(24)34-17-8-12-28(32)33/h6-7,10-11,13-16,18-19,23H,4-5,8-9,12,17H2,1-3H3,(H,29,31)(H,32,33)/b20-18+ |
| InChIKey | GAEODNOTWSPTDD-CZIZESTLSA-N |
| XLogP | 6.68 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|