C26H33N3O5 — CID 10027594
3-(1,3-benzodioxol-5-yl)-5-[1-[4-(pyridin-2-ylamino)butanoyl]piperidin-4-yl]pentanoic acid (PubChem CID 10027594) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-[1-[4-(pyridin-2-ylamino)butanoyl]piperidin-4-yl]pentanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-[1-[4-(pyridin-2-ylamino)butanoyl]piperidin-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 10027594 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-[1-[4-(pyridin-2-ylamino)butanoyl]piperidin-4-yl]pentanoic acid |
| SMILES | O=C(O)CC(CCC1CCN(C(=O)CCCNc2ccccn2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H33N3O5/c30-25(5-3-13-28-24-4-1-2-12-27-24)29-14-10-19(11-15-29)6-7-21(17-26(31)32)20-8-9-22-23(16-20)34-18-33-22/h1-2,4,8-9,12,16,19,21H,3,5-7,10-11,13-15,17-18H2,(H,27,28)(H,31,32) |
| InChIKey | SNBAIHVFRNLVLR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|