C26H49N3O4 — CID 10027606
(E,4S)-4-[[(2S)-2-[[(2S)-3,3-dimethyl-2-(methylamino)octanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 10027606) has the molecular formula C26H49N3O4 and a molecular weight of 467.70 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-[[(2S)-3,3-dimethyl-2-(methylamino)octanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (E,4S)-4-[[(2S)-2-[[(2S)-3,3-dimethyl-2-(methylamino)octanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 10027606 |
| Molecular Formula | C26H49N3O4 |
| Molecular Weight | 467.70 g/mol |
| Exact Mass | 467.37 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-[[(2S)-3,3-dimethyl-2-(methylamino)octanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | CCCCCC(C)(C)[C@H](NC)C(=O)N[C@H](C(=O)N(C)[C@H](/C=C(\C)C(=O)O)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H49N3O4/c1-12-13-14-15-26(8,9)20(27-10)22(30)28-21(25(5,6)7)23(31)29(11)19(17(2)3)16-18(4)24(32)33/h16-17,19-21,27H,12-15H2,1-11H3,(H,28,30)(H,32,33)/b18-16+/t19-,20-,21-/m1/s1 |
| InChIKey | BTDQBTGSEHAOHZ-KDBUHVHTSA-N |
| XLogP | 4.23 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|