C23H22BrN3O3 — CID 10027619
ethyl 3-[[2-(2-aminophenyl)-3-bromo-1-benzofuran-5-yl]methyl]-2,5-dimethylimidazole-4-carboxylate (PubChem CID 10027619) has the molecular formula C23H22BrN3O3 and a molecular weight of 468.35 g/mol. Its IUPAC name is ethyl 3-[[2-(2-aminophenyl)-3-bromo-1-benzofuran-5-yl]methyl]-2,5-dimethylimidazole-4-carboxylate.
| Compound Name | ethyl 3-[[2-(2-aminophenyl)-3-bromo-1-benzofuran-5-yl]methyl]-2,5-dimethylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 10027619 |
| Molecular Formula | C23H22BrN3O3 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | ethyl 3-[[2-(2-aminophenyl)-3-bromo-1-benzofuran-5-yl]methyl]-2,5-dimethylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(C)n1Cc1ccc2oc(-c3ccccc3N)c(Br)c2c1 |
| InChI | InChI=1S/C23H22BrN3O3/c1-4-29-23(28)21-13(2)26-14(3)27(21)12-15-9-10-19-17(11-15)20(24)22(30-19)16-7-5-6-8-18(16)25/h5-11H,4,12,25H2,1-3H3 |
| InChIKey | KSWSWBSVKLPRIA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|