C29H32N4O2 — CID 10027636
2-[N-(cyclopropylmethyl)-4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]anilino]-2-phenylacetic acid (PubChem CID 10027636) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-[N-(cyclopropylmethyl)-4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]anilino]-2-phenylacetic acid.
| Compound Name | 2-[N-(cyclopropylmethyl)-4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]anilino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 10027636 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-[N-(cyclopropylmethyl)-4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]anilino]-2-phenylacetic acid |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(N(CC2CC2)C(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N4O2/c1-4-25-31-26-19(2)16-20(3)30-28(26)33(25)18-22-12-14-24(15-13-22)32(17-21-10-11-21)27(29(34)35)23-8-6-5-7-9-23/h5-9,12-16,21,27H,4,10-11,17-18H2,1-3H3,(H,34,35) |
| InChIKey | FGABYXXTYUSGCF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|