C25H38FN7O — CID 10027753
6-N-cycloheptyl-4-N-(3-fluoro-4-methoxyphenyl)-2-N,4-N-dimethyl-2-N-(1-methylpiperidin-3-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 10027753) has the molecular formula C25H38FN7O and a molecular weight of 471.63 g/mol. Its IUPAC name is 6-N-cycloheptyl-4-N-(3-fluoro-4-methoxyphenyl)-2-N,4-N-dimethyl-2-N-(1-methylpiperidin-3-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-cycloheptyl-4-N-(3-fluoro-4-methoxyphenyl)-2-N,4-N-dimethyl-2-N-(1-methylpiperidin-3-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 10027753 |
| Molecular Formula | C25H38FN7O |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | 6-N-cycloheptyl-4-N-(3-fluoro-4-methoxyphenyl)-2-N,4-N-dimethyl-2-N-(1-methylpiperidin-3-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(N(C)c2nc(NC3CCCCCC3)nc(N(C)C3CCCN(C)C3)n2)cc1F |
| InChI | InChI=1S/C25H38FN7O/c1-31-15-9-12-20(17-31)33(3)25-29-23(27-18-10-7-5-6-8-11-18)28-24(30-25)32(2)19-13-14-22(34-4)21(26)16-19/h13-14,16,18,20H,5-12,15,17H2,1-4H3,(H,27,28,29,30) |
| InChIKey | BBXAVAGGEVTBGQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |