C27H38Cl2N2O — CID 10028011
1-decyl-5-[2-(3,4-dichlorophenyl)ethylamino]-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 10028011) has the molecular formula C27H38Cl2N2O and a molecular weight of 477.52 g/mol. Its IUPAC name is 1-decyl-5-[2-(3,4-dichlorophenyl)ethylamino]-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 1-decyl-5-[2-(3,4-dichlorophenyl)ethylamino]-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 10028011 |
| Molecular Formula | C27H38Cl2N2O |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1-decyl-5-[2-(3,4-dichlorophenyl)ethylamino]-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CCCCCCCCCCn1c2c(ccc1=O)C(NCCc1ccc(Cl)c(Cl)c1)CCC2 |
| InChI | InChI=1S/C27H38Cl2N2O/c1-2-3-4-5-6-7-8-9-19-31-26-12-10-11-25(22(26)14-16-27(31)32)30-18-17-21-13-15-23(28)24(29)20-21/h13-16,20,25,30H,2-12,17-19H2,1H3 |
| InChIKey | GYYSGASXMWPXSL-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|