C27H50O5Si — CID 10028225
methyl (E,2S,3S,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,8,10-pentamethyl-12-methylidene-9-oxotetradec-6-enoate (PubChem CID 10028225) has the molecular formula C27H50O5Si and a molecular weight of 482.78 g/mol. Its IUPAC name is methyl (E,2S,3S,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,8,10-pentamethyl-12-methylidene-9-oxotetradec-6-enoate.
| Compound Name | methyl (E,2S,3S,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,8,10-pentamethyl-12-methylidene-9-oxotetradec-6-enoate |
|---|---|
| PubChem CID | 10028225 |
| Molecular Formula | C27H50O5Si |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | methyl (E,2S,3S,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,8,10-pentamethyl-12-methylidene-9-oxotetradec-6-enoate |
| SMILES | C=C(CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)[C@H](C)/C=C(\C)C[C@H](C)[C@H](O)[C@H](C)C(=O)OC |
| InChI | InChI=1S/C27H50O5Si/c1-14-18(3)25(32-33(12,13)27(8,9)10)21(6)23(28)19(4)15-17(2)16-20(5)24(29)22(7)26(30)31-11/h15,19-22,24-25,29H,3,14,16H2,1-2,4-13H3/b17-15+/t19-,20+,21-,22+,24+,25-/m1/s1 |
| InChIKey | CCGZAMZSRDNFQW-JZUJFJQLSA-N |
| XLogP | 6.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|