C26H34FN5O3 — CID 10028254
2-[[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl-ethylamino]ethanol (PubChem CID 10028254) has the molecular formula C26H34FN5O3 and a molecular weight of 483.59 g/mol. Its IUPAC name is 2-[[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl-ethylamino]ethanol.
| Compound Name | 2-[[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl-ethylamino]ethanol |
|---|---|
| PubChem CID | 10028254 |
| Molecular Formula | C26H34FN5O3 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 2-[[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl-ethylamino]ethanol |
| SMILES | CCN(CCO)Cc1cccc(OC[C@@H]2CC[C@H]3CN(c4noc5ccc(F)cc45)CCN3C2)n1 |
| InChI | InChI=1S/C26H34FN5O3/c1-2-30(12-13-33)16-21-4-3-5-25(28-21)34-18-19-6-8-22-17-32(11-10-31(22)15-19)26-23-14-20(27)7-9-24(23)35-29-26/h3-5,7,9,14,19,22,33H,2,6,8,10-13,15-18H2,1H3/t19-,22+/m1/s1 |
| InChIKey | NGUJXBGCQFUJMP-KNQAVFIVSA-N |
| XLogP | 3.16 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |