C24H36O6S2 — CID 10028315
(4R,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(1R)-2-(1,3-dithian-2-yl)-1-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10028315) has the molecular formula C24H36O6S2 and a molecular weight of 484.68 g/mol. Its IUPAC name is (4R,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(1R)-2-(1,3-dithian-2-yl)-1-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(1R)-2-(1,3-dithian-2-yl)-1-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10028315 |
| Molecular Formula | C24H36O6S2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | (4R,5R)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(1R)-2-(1,3-dithian-2-yl)-1-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | COc1ccc(CO[C@H](CC2SCCCS2)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C24H36O6S2/c1-23(2)27-15-19(28-23)22-21(29-24(3,4)30-22)18(13-20-31-11-6-12-32-20)26-14-16-7-9-17(25-5)10-8-16/h7-10,18-22H,6,11-15H2,1-5H3/t18-,19-,21-,22-/m1/s1 |
| InChIKey | XZPLRYBSZQMUSV-UGESXGAOSA-N |
| XLogP | 4.84 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |