C29H40O4S — CID 10028319
(1S,3R,9S,10R,13R,14R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-1,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,3-diol (PubChem CID 10028319) has the molecular formula C29H40O4S and a molecular weight of 484.70 g/mol. Its IUPAC name is (1S,3R,9S,10R,13R,14R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-1,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (1S,3R,9S,10R,13R,14R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-1,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 10028319 |
| Molecular Formula | C29H40O4S |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (1S,3R,9S,10R,13R,14R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-1,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1,3-diol |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](O)C[C@](C)(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H40O4S/c1-19(18-34(32,33)22-8-6-5-7-9-22)24-12-13-25-23-11-10-20-16-21(30)17-28(3,31)29(20,4)26(23)14-15-27(24,25)2/h5-11,19,21,24-26,30-31H,12-18H2,1-4H3/t19-,21-,24-,25+,26+,27-,28+,29+/m1/s1 |
| InChIKey | NBJVZTWZJVVYTL-DSYWCFEPSA-N |
| XLogP | 5.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |