C11H2Cl10 — CID 10028465
1,1,2,3,4,4,5,6,8-nonachloro-7-(chloromethyl)naphthalene (PubChem CID 10028465) has the molecular formula C11H2Cl10 and a molecular weight of 488.67 g/mol. Its IUPAC name is 1,1,2,3,4,4,5,6,8-nonachloro-7-(chloromethyl)naphthalene.
| Compound Name | 1,1,2,3,4,4,5,6,8-nonachloro-7-(chloromethyl)naphthalene |
|---|---|
| PubChem CID | 10028465 |
| Molecular Formula | C11H2Cl10 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 483.70 |
| IUPAC Name | 1,1,2,3,4,4,5,6,8-nonachloro-7-(chloromethyl)naphthalene |
| SMILES | ClCc1c(Cl)c(Cl)c2c(c1Cl)C(Cl)(Cl)C(Cl)=C(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C11H2Cl10/c12-1-2-5(13)3-4(7(15)6(2)14)11(20,21)9(17)8(16)10(3,18)19/h1H2 |
| InChIKey | XZDNTUCQZLVWBM-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|