C21H34F3N7O3 — CID 10028493
N-[(2R)-2-[[[4-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]-6-methylheptyl]-N-hydroxyformamide (PubChem CID 10028493) has the molecular formula C21H34F3N7O3 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-[(2R)-2-[[[4-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]-6-methylheptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[[4-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]-6-methylheptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 10028493 |
| Molecular Formula | C21H34F3N7O3 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-[(2R)-2-[[[4-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]-6-methylheptyl]-N-hydroxyformamide |
| SMILES | CCN1CCN(c2cc(C(F)(F)F)nc(NNC(=O)[C@H](CCCC(C)C)CN(O)C=O)n2)CC1 |
| InChI | InChI=1S/C21H34F3N7O3/c1-4-29-8-10-30(11-9-29)18-12-17(21(22,23)24)25-20(26-18)28-27-19(33)16(13-31(34)14-32)7-5-6-15(2)3/h12,14-16,34H,4-11,13H2,1-3H3,(H,27,33)(H,25,26,28)/t16-/m1/s1 |
| InChIKey | JQMNTVJSWFHFLX-MRXNPFEDSA-N |
| XLogP | 2.37 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|