C23H27FN4O5S — CID 10028535
N-[[(5S)-3-[3-fluoro-4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10028535) has the molecular formula C23H27FN4O5S and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10028535 |
| Molecular Formula | C23H27FN4O5S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(S(=O)(=O)c4ccc(C)cc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H27FN4O5S/c1-16-3-6-20(7-4-16)34(31,32)27-11-9-26(10-12-27)22-8-5-18(13-21(22)24)28-15-19(33-23(28)30)14-25-17(2)29/h3-8,13,19H,9-12,14-15H2,1-2H3,(H,25,29)/t19-/m0/s1 |
| InChIKey | ZUIGQRKRMMZNCD-IBGZPJMESA-N |
| XLogP | 2.11 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|