C22H26INO4 — CID 10028733
(1R,2R,7S,9S)-8,8-dimethyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane iodide (PubChem CID 10028733) has the molecular formula C22H26INO4 and a molecular weight of 495.36 g/mol. Its IUPAC name is (1R,2R,7S,9S)-8,8-dimethyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane iodide.
| Compound Name | (1R,2R,7S,9S)-8,8-dimethyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane iodide |
|---|---|
| PubChem CID | 10028733 |
| Molecular Formula | C22H26INO4 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | (1R,2R,7S,9S)-8,8-dimethyl-4,12-diphenyl-3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane iodide |
| SMILES | C[N+]1(C)[C@H]2COC(c3ccccc3)O[C@H]2[C@@H]2OC(c3ccccc3)OC[C@@H]21.[I-] |
| InChI | InChI=1S/C22H26NO4.HI/c1-23(2)17-13-24-21(15-9-5-3-6-10-15)26-19(17)20-18(23)14-25-22(27-20)16-11-7-4-8-12-16;/h3-12,17-22H,13-14H2,1-2H3;1H/q+1;/p-1/t17-,18-,19+,20+,21?,22?;/m0./s1 |
| InChIKey | PCJYKVHZACVFOM-PPJNAJQWSA-M |
| XLogP | 0.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|